Difference between revisions of "TESTOSTERONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Tubulin-Heterodimers == * common-name: ** an α/β tubulin heterodimer == Reaction(s) known to consume the compound == == Reacti...") |
(Created page with "Category:metabolite == Metabolite CPD-7496 == * common-name: ** prolycopene * smiles: ** cc(=cccc(=cc=cc(c)=cc=cc(=cc=cc=c(c=cc=c(c)c=cc=c(ccc=c(c)c)c)c)c)c)c * inchi-key:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-7496 == |
* common-name: | * common-name: | ||
| − | ** | + | ** prolycopene |
| + | * smiles: | ||
| + | ** cc(=cccc(=cc=cc(c)=cc=cc(=cc=cc=c(c=cc=c(c)c=cc=c(ccc=c(c)c)c)c)c)c)c | ||
| + | * inchi-key: | ||
| + | ** oaijszizwzsqbc-byunhuqqsa-n | ||
| + | * molecular-weight: | ||
| + | ** 536.882 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-8042]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-11357]] |
| + | * [[RXN-12242]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=prolycopene}} |
| + | {{#set: inchi-key=inchikey=oaijszizwzsqbc-byunhuqqsa-n}} | ||
| + | {{#set: molecular-weight=536.882}} | ||
Revision as of 11:17, 15 January 2021
Contents
Metabolite CPD-7496
- common-name:
- prolycopene
- smiles:
- cc(=cccc(=cc=cc(c)=cc=cc(=cc=cc=c(c=cc=c(c)c=cc=c(ccc=c(c)c)c)c)c)c)c
- inchi-key:
- oaijszizwzsqbc-byunhuqqsa-n
- molecular-weight:
- 536.882
