Difference between revisions of "TESTOSTERONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7496 == * common-name: ** prolycopene * smiles: ** cc(=cccc(=cc=cc(c)=cc=cc(=cc=cc=c(c=cc=c(c)c=cc=c(ccc=c(c)c)c)c)c)c)c * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite 4-METHYLCATECHOL == * common-name: ** 4-methylcatechol * smiles: ** cc1(c=cc(o)=c(c=1)o) * inchi-key: ** zbcatmyqydctiz-uhfffaoysa-n * mo...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 4-METHYLCATECHOL == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-methylcatechol |
* smiles: | * smiles: | ||
| − | ** | + | ** cc1(c=cc(o)=c(c=1)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zbcatmyqydctiz-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 124.139 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-10078]] |
| − | * [[RXN- | + | * [[RXN-10079]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-methylcatechol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zbcatmyqydctiz-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=124.139}} |
Revision as of 08:28, 15 March 2021
Contents
Metabolite 4-METHYLCATECHOL
- common-name:
- 4-methylcatechol
- smiles:
- cc1(c=cc(o)=c(c=1)o)
- inchi-key:
- zbcatmyqydctiz-uhfffaoysa-n
- molecular-weight:
- 124.139
