Difference between revisions of "TESTOSTERONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7496 == * common-name: ** prolycopene * smiles: ** cc(=cccc(=cc=cc(c)=cc=cc(=cc=cc=c(c=cc=c(c)c=cc=c(ccc=c(c)c)c)c)c)c)c * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite TESTOSTERONE == * common-name: ** testosterone * smiles: ** cc34([ch]2([ch]([ch]1(c(c)(c(o)cc1)cc2))ccc3=cc(=o)cc4)) * inchi-key: ** mumg...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite TESTOSTERONE == |
* common-name: | * common-name: | ||
| − | ** | + | ** testosterone |
* smiles: | * smiles: | ||
| − | ** | + | ** cc34([ch]2([ch]([ch]1(c(c)(c(o)cc1)cc2))ccc3=cc(=o)cc4)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** mumggozamzwbjj-dykiifrcsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 288.429 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[1.1.1.51-RXN]] |
| + | * [[RXN66-343]] | ||
| + | * [[TESTOSTERONE-17-BETA-DEHYDROGENASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[1.1.1.64-RXN]] |
| − | * [[RXN | + | * [[TESTOSTERONE-17-BETA-DEHYDROGENASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=testosterone}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mumggozamzwbjj-dykiifrcsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=288.429}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite TESTOSTERONE
- common-name:
- testosterone
- smiles:
- cc34([ch]2([ch]([ch]1(c(c)(c(o)cc1)cc2))ccc3=cc(=o)cc4))
- inchi-key:
- mumggozamzwbjj-dykiifrcsa-n
- molecular-weight:
- 288.429
