Difference between revisions of "TESTOSTERONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16129 RXN-16129] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:metabolite == Metabolite L-GULONATE == * common-name: ** l-gulonate * smiles: ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-] * inchi-key: ** rghnjxzeokukbd-qtbdoelssa-m * molec...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16129 RXN-16129] ==
+
== Metabolite L-GULONATE ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** l-gulonate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.1.1.330 ec-1.1.1.330]
+
** c(o)c(o)c(o)c(o)c(o)c(=o)[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-17332]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-17382]][c] '''+''' 1 [[NADP]][c]
+
** rghnjxzeokukbd-qtbdoelssa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ06969]]
+
** 195.149
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[GLUCURONATE-REDUCTASE-RXN]]
−
* [[PWY-7606]], docosahexaenoate biosynthesis III (6-desaturase, mammals): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7606 PWY-7606]
+
* [[RXN-8783]]
−
** '''8''' reactions found over '''14''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
−
== Reconstruction information  ==
+
{{#set: common-name=l-gulonate}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=rghnjxzeokukbd-qtbdoelssa-m}}
−
== External links  ==
+
{{#set: molecular-weight=195.149}}
−
{{#set: direction=left-to-right}}
 
−
{{#set: ec-number=ec-1.1.1.330}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:34, 18 December 2020

Metabolite L-GULONATE

  • common-name:
    • l-gulonate
  • smiles:
    • c(o)c(o)c(o)c(o)c(o)c(=o)[o-]
  • inchi-key:
    • rghnjxzeokukbd-qtbdoelssa-m
  • molecular-weight:
    • 195.149

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=TESTOSTERONE&oldid=47366"