Difference between revisions of "TESTOSTERONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14115 == * common-name: ** (s)-equol * smiles: ** c3(c(c1(cc2(=cc=c(c=c(oc1)2)o)))=cc=c(c=3)o) * inchi-key: ** adfcqwzhkcxpaj-gfccveg...") |
(Created page with "Category:metabolite == Metabolite Tubulin-Heterodimers == * common-name: ** an α/β tubulin heterodimer == Reaction(s) known to consume the compound == == Reacti...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Tubulin-Heterodimers == |
* common-name: | * common-name: | ||
| − | ** | + | ** an α/β tubulin heterodimer |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[3.6.4.3-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an α/β tubulin heterodimer}} |
| − | |||
| − | |||
Revision as of 18:56, 14 January 2021
Contents
Metabolite Tubulin-Heterodimers
- common-name:
- an α/β tubulin heterodimer
