Difference between revisions of "TETRADECANOYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD1G-120 == * common-name: ** deacetylmycothiol * smiles: ** c(o)c2(c(c(c(nc(=o)c([n+])cs)c(oc1(c(o)c(o)c(o)c(o)c(o)1))o2)o)o) * inchi-k...") |
(Created page with "Category:metabolite == Metabolite TETRADECANOYL-COA == * common-name: ** myristoyl-coa * smiles: ** cccccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op(...") |
||
| (3 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite TETRADECANOYL-COA == |
* common-name: | * common-name: | ||
| − | ** | + | ** myristoyl-coa |
* smiles: | * smiles: | ||
| − | ** | + | ** cccccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** duafkxofbzqtqe-qsgbvpjfsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 973.861 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[2.3.1.97-RXN]] | ||
| + | * [[ACACT7]] | ||
| + | * [[ACACT7h]] | ||
| + | * [[ACACT7m]] | ||
| + | * [[ACOA140OR]] | ||
| + | * [[RXN-17021]] | ||
| + | * [[RXN-17023]] | ||
| + | * [[RXN-9626]] | ||
| + | * [[RXN3O-8214]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ACACT7]] |
| + | * [[RXN3O-8214]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=myristoyl-coa}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=duafkxofbzqtqe-qsgbvpjfsa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=973.861}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite TETRADECANOYL-COA
- common-name:
- myristoyl-coa
- smiles:
- cccccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- duafkxofbzqtqe-qsgbvpjfsa-j
- molecular-weight:
- 973.861
