Difference between revisions of "TETRADEHYDROACYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8999 == * common-name: ** 5-(methylsulfanyl)-2,3-dioxopentyl 1-phosphate * smiles: ** csccc(=o)c(=o)cop([o-])(=o)[o-] * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite TETRADEHYDROACYL-COA == * common-name: ** a (2e,4e)-alkane-2,4-dienoyl-coa == Reaction(s) known to consume the compound == * [[RXN-12521]...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite TETRADEHYDROACYL-COA == |
* common-name: | * common-name: | ||
| − | ** | + | ** a (2e,4e)-alkane-2,4-dienoyl-coa |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-12521]] | ||
| + | * [[RXN-7911]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a (2e,4e)-alkane-2,4-dienoyl-coa}} |
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite TETRADEHYDROACYL-COA
- common-name:
- a (2e,4e)-alkane-2,4-dienoyl-coa
