Difference between revisions of "THIAMINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Ubiquitin-activating-protein-E1-L-cys == * common-name: ** an [e1 ubiquitin-activating enzyme]-l-cysteine == Reaction(s) known to consume...")
(Created page with "Category:metabolite == Metabolite THIAMINE == * common-name: ** thiamine * smiles: ** cc1([n+](=csc(cco)=1)cc2(c=nc(c)=nc(n)=2)) * inchi-key: ** jzrwcgzrtzmzeh-uhfffaoysa-...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Ubiquitin-activating-protein-E1-L-cys ==
+
== Metabolite THIAMINE ==
 
* common-name:
 
* common-name:
** an [e1 ubiquitin-activating enzyme]-l-cysteine
+
** thiamine
 +
* smiles:
 +
** cc1([n+](=csc(cco)=1)cc2(c=nc(c)=nc(n)=2))
 +
* inchi-key:
 +
** jzrwcgzrtzmzeh-uhfffaoysa-n
 +
* molecular-weight:
 +
** 265.352
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15565]]
+
* [[ExchangeSeed-THIAMINE]]
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
+
* [[THIAMIN-PYROPHOSPHOKINASE-RXN]]
 +
* [[THIAMINASE-RXN]]
 +
* [[TransportSeed-THIAMINE]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15556]]
+
* [[ExchangeSeed-THIAMINE]]
* [[RXN-15563]]
+
* [[TransportSeed-THIAMINE]]
* [[RXN-15565]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an [e1 ubiquitin-activating enzyme]-l-cysteine}}
+
{{#set: common-name=thiamine}}
 +
{{#set: inchi-key=inchikey=jzrwcgzrtzmzeh-uhfffaoysa-n}}
 +
{{#set: molecular-weight=265.352}}

Latest revision as of 11:15, 18 March 2021

Metabolite THIAMINE

  • common-name:
    • thiamine
  • smiles:
    • cc1([n+](=csc(cco)=1)cc2(c=nc(c)=nc(n)=2))
  • inchi-key:
    • jzrwcgzrtzmzeh-uhfffaoysa-n
  • molecular-weight:
    • 265.352

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality