Difference between revisions of "THIAMINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13322 RXN-13322] == * direction: ** left-to-right * common-name: ** 3-oxo-(11z)-eicos-11-enoyl-...")
(Created page with "Category:metabolite == Metabolite THIAMINE == * common-name: ** thiamine * smiles: ** cc1([n+](=csc(cco)=1)cc2(c=nc(c)=nc(n)=2)) * inchi-key: ** jzrwcgzrtzmzeh-uhfffaoysa-...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13322 RXN-13322] ==
+
== Metabolite THIAMINE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 3-oxo-(11z)-eicos-11-enoyl-coa synthase
+
** thiamine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.3.1.199 ec-2.3.1.199]
+
** cc1([n+](=csc(cco)=1)cc2(c=nc(c)=nc(n)=2))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[MALONYL-COA]][c] '''+''' 1 [[OLEOYL-COA]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[CPD-14300]][c]
+
** jzrwcgzrtzmzeh-uhfffaoysa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ19629]]
+
** 265.352
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[ExchangeSeed-THIAMINE]]
−
* Gene: [[SJ06616]]
+
* [[THIAMIN-PYROPHOSPHOKINASE-RXN]]
−
** Category: [[annotation]]
+
* [[THIAMINASE-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[TransportSeed-THIAMINE]]
−
* Gene: [[SJ11672]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[ExchangeSeed-THIAMINE]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[TransportSeed-THIAMINE]]
−
* Gene: [[SJ00613]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=thiamine}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: inchi-key=inchikey=jzrwcgzrtzmzeh-uhfffaoysa-n}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=265.352}}
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
== Pathway(s) ==
 
−
* [[PWY-6433]], hydroxylated fatty acid biosynthesis (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6433 PWY-6433]
 
−
** '''17''' reactions found over '''22''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=3-oxo-(11z)-eicos-11-enoyl-coa synthase}}
 
−
{{#set: ec-number=ec-2.3.1.199}}
 
−
{{#set: nb gene associated=4}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology|annotation}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite THIAMINE

  • common-name:
    • thiamine
  • smiles:
    • cc1([n+](=csc(cco)=1)cc2(c=nc(c)=nc(n)=2))
  • inchi-key:
    • jzrwcgzrtzmzeh-uhfffaoysa-n
  • molecular-weight:
    • 265.352

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=THIAMINE&oldid=138432"