Difference between revisions of "THIAMINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4127 == * common-name: ** isofucosterol * smiles: ** cc=c(c(c)c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34)))) * inchi...") |
(Created page with "Category:metabolite == Metabolite THIAMINE == * common-name: ** thiamine * smiles: ** cc1([n+](=csc(cco)=1)cc2(c=nc(c)=nc(n)=2)) * inchi-key: ** jzrwcgzrtzmzeh-uhfffaoysa-...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite THIAMINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** thiamine |
* smiles: | * smiles: | ||
| − | ** | + | ** cc1([n+](=csc(cco)=1)cc2(c=nc(c)=nc(n)=2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** jzrwcgzrtzmzeh-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 265.352 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[ExchangeSeed-THIAMINE]] | ||
| + | * [[THIAMIN-PYROPHOSPHOKINASE-RXN]] | ||
| + | * [[THIAMINASE-RXN]] | ||
| + | * [[TransportSeed-THIAMINE]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ExchangeSeed-THIAMINE]] |
| + | * [[TransportSeed-THIAMINE]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=thiamine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jzrwcgzrtzmzeh-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=265.352}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite THIAMINE
- common-name:
- thiamine
- smiles:
- cc1([n+](=csc(cco)=1)cc2(c=nc(c)=nc(n)=2))
- inchi-key:
- jzrwcgzrtzmzeh-uhfffaoysa-n
- molecular-weight:
- 265.352
