Difference between revisions of "THIAMINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2145 RXN0-2145] == * direction: ** left-to-right * common-name: ** cis-δ5-dodecenoyl-[ac...")
 
(Created page with "Category:metabolite == Metabolite THIAMINE == * common-name: ** thiamine * smiles: ** cc1([n+](=csc(cco)=1)cc2(c=nc(c)=nc(n)=2)) * inchi-key: ** jzrwcgzrtzmzeh-uhfffaoysa-...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2145 RXN0-2145] ==
+
== Metabolite THIAMINE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** cis-δ5-dodecenoyl-[acp]:nad+ oxidoreductase
+
** thiamine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.3.1.9 ec-1.3.1.9]
+
** cc1([n+](=csc(cco)=1)cc2(c=nc(c)=nc(n)=2))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Trans-D3-cis-D5-dodecenoyl-ACPs]][c] '''=>''' 1 [[Cis-Delta5-dodecenoyl-ACPs]][c] '''+''' 1 [[NAD]][c]
+
** jzrwcgzrtzmzeh-uhfffaoysa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ03883]]
+
** 265.352
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[ExchangeSeed-THIAMINE]]
−
** Category: [[orthology]]
+
* [[THIAMIN-PYROPHOSPHOKINASE-RXN]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[THIAMINASE-RXN]]
−
* Gene: [[SJ00320]]
+
* [[TransportSeed-THIAMINE]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[ExchangeSeed-THIAMINE]]
−
== Pathway(s) ==
+
* [[TransportSeed-THIAMINE]]
−
* [[PWY-7858]], (5Z)-dodecenoate biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7858 PWY-7858]
+
== Reaction(s) of unknown directionality ==
−
** '''4''' reactions found over '''6''' reactions in the full pathway
+
{{#set: common-name=thiamine}}
−
* [[PWY0-862]], (5Z)-dodecenoate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-862 PWY0-862]
+
{{#set: inchi-key=inchikey=jzrwcgzrtzmzeh-uhfffaoysa-n}}
−
** '''5''' reactions found over '''6''' reactions in the full pathway
+
{{#set: molecular-weight=265.352}}
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=cis-δ5-dodecenoyl-[acp]:nad+ oxidoreductase}}
 
−
{{#set: ec-number=ec-1.3.1.9}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=orthology|annotation}}
 
−
{{#set: reconstruction tool=pathwaytools|pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite THIAMINE

  • common-name:
    • thiamine
  • smiles:
    • cc1([n+](=csc(cco)=1)cc2(c=nc(c)=nc(n)=2))
  • inchi-key:
    • jzrwcgzrtzmzeh-uhfffaoysa-n
  • molecular-weight:
    • 265.352

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=THIAMINE&oldid=138432"