Difference between revisions of "THIAMINE"

Revision as of 14:57, 5 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-4127 ==
+== Metabolite S-ADENOSYLMETHIONINAMINE ==
 * common-name:
-** isofucosterol
+** s-adenosyl 3-(methylthio)propylamine
 * smiles:
-** cc=c(c(c)c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
+** c[s+](ccc[n+])cc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23)))
 * inchi-key:
-** oselkochbmdkej-wgmizeqosa-n
+** zunbitixdcpnsd-lsrjevitsa-o
 * molecular-weight:
-** 412.698
+** 356.442
 == Reaction(s) known to consume the compound ==
+* [[APAPT]]
+* [[RXN-11190]]
+* [[RXN0-5217]]
+* [[SPERMIDINESYN-RXN]]
+* [[SPERMINE-SYNTHASE-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-4210]]
+* [[AMCL]]
+* [[RXN-11190]]
+* [[SAMDECARB-RXN]]
+* [[SPERMIDINESYN-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=isofucosterol}}
+{{#set: common-name=s-adenosyl 3-(methylthio)propylamine}}
-{{#set: inchi-key=inchikey=oselkochbmdkej-wgmizeqosa-n}}
+{{#set: inchi-key=inchikey=zunbitixdcpnsd-lsrjevitsa-o}}
-{{#set: molecular-weight=412.698}}
+{{#set: molecular-weight=356.442}}