Difference between revisions of "THIAMINE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ17449 == * transcription-direction: ** negative * right-end-position: ** 506322 * left-end-position: ** 487433 * centisome-position: ** 72.07231...") |
(Created page with "Category:metabolite == Metabolite THIAMINE == * common-name: ** thiamine * smiles: ** cc1([n+](=csc(cco)=1)cc2(c=nc(c)=nc(n)=2)) * inchi-key: ** jzrwcgzrtzmzeh-uhfffaoysa-...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite THIAMINE == |
− | * | + | * common-name: |
− | ** | + | ** thiamine |
− | * | + | * smiles: |
− | ** | + | ** cc1([n+](=csc(cco)=1)cc2(c=nc(c)=nc(n)=2)) |
− | * | + | * inchi-key: |
− | ** | + | ** jzrwcgzrtzmzeh-uhfffaoysa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 265.352 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[ExchangeSeed-THIAMINE]] |
− | + | * [[THIAMIN-PYROPHOSPHOKINASE-RXN]] | |
− | * [[ | + | * [[THIAMINASE-RXN]] |
− | * | + | * [[TransportSeed-THIAMINE]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | * [[ | + | * [[ExchangeSeed-THIAMINE]] |
− | * | + | * [[TransportSeed-THIAMINE]] |
− | + | == Reaction(s) of unknown directionality == | |
− | {{#set: | + | {{#set: common-name=thiamine}} |
− | {{#set: | + | {{#set: inchi-key=inchikey=jzrwcgzrtzmzeh-uhfffaoysa-n}} |
− | + | {{#set: molecular-weight=265.352}} | |
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite THIAMINE
- common-name:
- thiamine
- smiles:
- cc1([n+](=csc(cco)=1)cc2(c=nc(c)=nc(n)=2))
- inchi-key:
- jzrwcgzrtzmzeh-uhfffaoysa-n
- molecular-weight:
- 265.352