Difference between revisions of "THIAMINE-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ00186 == * transcription-direction: ** negative * right-end-position: ** 38296 * left-end-position: ** 21966 * centisome-position: ** 12.89077...")
(Created page with "Category:metabolite == Metabolite THIAMINE-P == * common-name: ** thiamine phosphate * smiles: ** cc1([n+](=csc(ccop([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2)) * inchi-key: **...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ00186 ==
+
== Metabolite THIAMINE-P ==
* transcription-direction:
+
* common-name:
** negative
+
** thiamine phosphate
* right-end-position:
+
* smiles:
** 38296
+
** cc1([n+](=csc(ccop([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
* left-end-position:
+
* inchi-key:
** 21966
+
** hzsajdvwzrbgif-uhfffaoysa-m
* centisome-position:
+
* molecular-weight:
** 12.89077   
+
** 343.317
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN0-3542]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[RXN-12673]]
+
* [[RXN-12610]]
** Category: [[annotation]]
+
* [[RXN-12611]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN0-3542]]
{{#set: transcription-direction=negative}}
+
* [[THI-P-SYN-RXN]]
{{#set: right-end-position=38296}}
+
== Reaction(s) of unknown directionality ==
{{#set: left-end-position=21966}}
+
{{#set: common-name=thiamine phosphate}}
{{#set: centisome-position=12.89077    }}
+
{{#set: inchi-key=inchikey=hzsajdvwzrbgif-uhfffaoysa-m}}
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
{{#set: molecular-weight=343.317}}
{{#set: nb reaction associated=1}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite THIAMINE-P

  • common-name:
    • thiamine phosphate
  • smiles:
    • cc1([n+](=csc(ccop([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
  • inchi-key:
    • hzsajdvwzrbgif-uhfffaoysa-m
  • molecular-weight:
    • 343.317

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality