Difference between revisions of "THIAMINE-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ14599 == * transcription-direction: ** positive * right-end-position: ** 213375 * left-end-position: ** 197281 * centisome-position: ** 63.316322...")
 
(Created page with "Category:metabolite == Metabolite THIAMINE-P == * common-name: ** thiamine phosphate * smiles: ** cc1([n+](=csc(ccop([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2)) * inchi-key: **...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ14599 ==
+
== Metabolite THIAMINE-P ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** thiamine phosphate
−
* right-end-position:
+
* smiles:
−
** 213375
+
** cc1([n+](=csc(ccop([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
−
* left-end-position:
+
* inchi-key:
−
** 197281
+
** hzsajdvwzrbgif-uhfffaoysa-m
−
* centisome-position:
+
* molecular-weight:
−
** 63.316322   
+
** 343.317
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN0-3542]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[DAPASYN-RXN]]
+
* [[RXN-12610]]
−
** Category: [[annotation]]
+
* [[RXN-12611]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN0-3542]]
−
** Category: [[orthology]]
+
* [[THI-P-SYN-RXN]]
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: common-name=thiamine phosphate}}
−
* [[DETHIOBIOTIN-SYN-RXN]]
+
{{#set: inchi-key=inchikey=hzsajdvwzrbgif-uhfffaoysa-m}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=343.317}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY0-1507]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-7380]]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=213375}}
 
−
{{#set: left-end-position=197281}}
 
−
{{#set: centisome-position=63.316322    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=2}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite THIAMINE-P

  • common-name:
    • thiamine phosphate
  • smiles:
    • cc1([n+](=csc(ccop([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
  • inchi-key:
    • hzsajdvwzrbgif-uhfffaoysa-m
  • molecular-weight:
    • 343.317

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=THIAMINE-P&oldid=138006"