Difference between revisions of "THIAMINE-P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-BETA-D-GLUCOSYLGLUCOSE == * common-name: ** nigerose * smiles: ** c(o)c2(c(o)c(o)c(o)c(oc1(c(o)c(o)oc(co)c(o)1))o2) * inchi-key: ** qig...") |
(Created page with "Category:metabolite == Metabolite 4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S == * common-name: ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate * s...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate |
* smiles: | * smiles: | ||
| − | ** c(o) | + | ** cc(=o)nc2(c(o)oc(cos(=o)(=o)[o-])c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** bujztfindcqrgp-ztvljyeesa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 457.362 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-12177]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bujztfindcqrgp-ztvljyeesa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=457.362}} |
Revision as of 15:27, 5 January 2021
Contents
Metabolite 4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S
- common-name:
- 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate
- smiles:
- cc(=o)nc2(c(o)oc(cos(=o)(=o)[o-])c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2)
- inchi-key:
- bujztfindcqrgp-ztvljyeesa-l
- molecular-weight:
- 457.362
