Difference between revisions of "THIAMINE-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S == * common-name: ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate * s...")
(Created page with "Category:metabolite == Metabolite CPDMETA-13652 == * common-name: ** raucaffrinoline * smiles: ** cc3(n5(c2(c1(=nc6(=cc=cc=c(c41(c(c(c(c2)c(co)3)c(c4)5)oc(=o)c))6))))) * i...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S ==
+
== Metabolite CPDMETA-13652 ==
 
* common-name:
 
* common-name:
** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate
+
** raucaffrinoline
 
* smiles:
 
* smiles:
** cc(=o)nc2(c(o)oc(cos(=o)(=o)[o-])c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2)
+
** cc3(n5(c2(c1(=nc6(=cc=cc=c(c41(c(c(c(c2)c(co)3)c(c4)5)oc(=o)c))6)))))
 
* inchi-key:
 
* inchi-key:
** bujztfindcqrgp-ztvljyeesa-l
+
** ximpcxfldskalh-vqhwpedhsa-n
 
* molecular-weight:
 
* molecular-weight:
** 457.362
+
** 352.432
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12177]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12673]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate}}
+
{{#set: common-name=raucaffrinoline}}
{{#set: inchi-key=inchikey=bujztfindcqrgp-ztvljyeesa-l}}
+
{{#set: inchi-key=inchikey=ximpcxfldskalh-vqhwpedhsa-n}}
{{#set: molecular-weight=457.362}}
+
{{#set: molecular-weight=352.432}}

Revision as of 13:10, 14 January 2021

Metabolite CPDMETA-13652

  • common-name:
    • raucaffrinoline
  • smiles:
    • cc3(n5(c2(c1(=nc6(=cc=cc=c(c41(c(c(c(c2)c(co)3)c(c4)5)oc(=o)c))6)))))
  • inchi-key:
    • ximpcxfldskalh-vqhwpedhsa-n
  • molecular-weight:
    • 352.432

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality