Difference between revisions of "THIAMINE-PYROPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19160 == * common-name: ** 3-oxo-(11z)-octadecenoyl-coa * smiles: ** ccccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(o...")
(Created page with "Category:metabolite == Metabolite INDOLE == * common-name: ** indole * smiles: ** c2(c=cc1(=c(c=cn1)c=2)) * inchi-key: ** sikjaqjrhwyjai-uhfffaoysa-n * molecular-weight: *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19160 ==
+
== Metabolite INDOLE ==
 
* common-name:
 
* common-name:
** 3-oxo-(11z)-octadecenoyl-coa
+
** indole
 
* smiles:
 
* smiles:
** ccccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c2(c=cc1(=c(c=cn1)c=2))
 
* inchi-key:
 
* inchi-key:
** ourowzutgfhrje-saiinbspsa-j
+
** sikjaqjrhwyjai-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 1041.936
+
** 117.15
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17787]]
+
* [[INDOLE-23-DIOXYGENASE-RXN]]
 +
* [[RXN0-2381]]
 +
* [[RXN0-2382]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17786]]
+
* [[RXN0-2381]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-(11z)-octadecenoyl-coa}}
+
{{#set: common-name=indole}}
{{#set: inchi-key=inchikey=ourowzutgfhrje-saiinbspsa-j}}
+
{{#set: inchi-key=inchikey=sikjaqjrhwyjai-uhfffaoysa-n}}
{{#set: molecular-weight=1041.936}}
+
{{#set: molecular-weight=117.15}}

Revision as of 08:32, 15 March 2021

Metabolite INDOLE

  • common-name:
    • indole
  • smiles:
    • c2(c=cc1(=c(c=cn1)c=2))
  • inchi-key:
    • sikjaqjrhwyjai-uhfffaoysa-n
  • molecular-weight:
    • 117.15

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality