Difference between revisions of "THIAMINE-PYROPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7740 RXN-7740] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/1....")
(Created page with "Category:metabolite == Metabolite THIAMINE-PYROPHOSPHATE == * common-name: ** thiamine diphosphate * smiles: ** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7740 RXN-7740] ==
+
== Metabolite THIAMINE-PYROPHOSPHATE ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** thiamine diphosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.14.15.17 ec-1.14.15.17]
+
** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-7061]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[PROTON]][c] '''+''' 2 [[Reduced-ferredoxins]][c] '''=>''' 1 [[CPD-7063]][c] '''+''' 2 [[Oxidized-ferredoxins]][c]
+
** ayekofbpnlcajy-uhfffaoysa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ07178]]
+
** 422.288
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-12583]]
−
* Gene: [[SJ22309]]
+
* [[RXN-14037]]
−
** Category: [[annotation]]
+
* [[RXN0-3542]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ22311]]
+
* [[PDHam2hi]]
−
** Category: [[annotation]]
+
* [[PDHam2mi]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-12508]]
−
* Gene: [[SJ08869]]
+
* [[RXN-14037]]
−
** Category: [[annotation]]
+
* [[RXN0-3542]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[THIAMIN-PYROPHOSPHOKINASE-RXN]]
−
* Gene: [[SJ17313]]
+
* [[THIAMIN-TRIPHOSPHATASE-RXN]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=thiamine diphosphate}}
−
* Gene: [[SJ00278]]
+
{{#set: inchi-key=inchikey=ayekofbpnlcajy-uhfffaoysa-l}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=422.288}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
== Pathway(s) ==
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24759 24759]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R08921 R08921]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: ec-number=ec-1.14.15.17}}
 
−
{{#set: nb gene associated=6}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite THIAMINE-PYROPHOSPHATE

  • common-name:
    • thiamine diphosphate
  • smiles:
    • cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
  • inchi-key:
    • ayekofbpnlcajy-uhfffaoysa-l
  • molecular-weight:
    • 422.288

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=THIAMINE-PYROPHOSPHATE&oldid=139836"