Difference between revisions of "THIAMINE-PYROPHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17475 RXN-17475] == * direction: ** reversible * common-name: ** enoyl-coa hydratase * ec-numbe...") |
(Created page with "Category:metabolite == Metabolite THIAMINE-PYROPHOSPHATE == * common-name: ** thiamine diphosphate * smiles: ** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite THIAMINE-PYROPHOSPHATE == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** thiamine diphosphate |
− | * | + | * smiles: |
− | ** [ | + | ** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2)) |
− | = | + | * inchi-key: |
− | + | ** ayekofbpnlcajy-uhfffaoysa-l | |
− | == | + | * molecular-weight: |
− | + | ** 422.288 | |
− | + | == Reaction(s) known to consume the compound == | |
− | ** | + | * [[RXN-12583]] |
− | + | * [[RXN-14037]] | |
− | + | * [[RXN0-3542]] | |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | * [[PDHam2hi]] | |
− | + | * [[PDHam2mi]] | |
− | ** | + | * [[RXN-12508]] |
− | + | * [[RXN-14037]] | |
− | * | + | * [[RXN0-3542]] |
− | * | + | * [[THIAMIN-PYROPHOSPHOKINASE-RXN]] |
− | + | * [[THIAMIN-TRIPHOSPHATASE-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | {{#set: common-name=thiamine diphosphate}} |
− | + | {{#set: inchi-key=inchikey=ayekofbpnlcajy-uhfffaoysa-l}} | |
− | + | {{#set: molecular-weight=422.288}} | |
− | * | ||
− | * | ||
− | * | ||
− | * | ||
− | * | ||
− | * | ||
− | |||
− | * | ||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite THIAMINE-PYROPHOSPHATE
- common-name:
- thiamine diphosphate
- smiles:
- cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
- inchi-key:
- ayekofbpnlcajy-uhfffaoysa-l
- molecular-weight:
- 422.288
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
- PDHam2hi
- PDHam2mi
- RXN-12508
- RXN-14037
- RXN0-3542
- THIAMIN-PYROPHOSPHOKINASE-RXN
- THIAMIN-TRIPHOSPHATASE-RXN