Difference between revisions of "THIAMINE-PYROPHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Oligomers-Of-16beta-D-Glucans == * common-name: ** a (1→6)-β-linked oligosaccharide == Reaction(s) known to consume the compoun...") |
(Created page with "Category:metabolite == Metabolite THIAMINE-PYROPHOSPHATE == * common-name: ** thiamine diphosphate * smiles: ** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)...") |
||
| (4 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite THIAMINE-PYROPHOSPHATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** thiamine diphosphate |
| + | * smiles: | ||
| + | ** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2)) | ||
| + | * inchi-key: | ||
| + | ** ayekofbpnlcajy-uhfffaoysa-l | ||
| + | * molecular-weight: | ||
| + | ** 422.288 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-12583]] | ||
| + | * [[RXN-14037]] | ||
| + | * [[RXN0-3542]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[PDHam2hi]] |
| + | * [[PDHam2mi]] | ||
| + | * [[RXN-12508]] | ||
| + | * [[RXN-14037]] | ||
| + | * [[RXN0-3542]] | ||
| + | * [[THIAMIN-PYROPHOSPHOKINASE-RXN]] | ||
| + | * [[THIAMIN-TRIPHOSPHATASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=thiamine diphosphate}} |
| + | {{#set: inchi-key=inchikey=ayekofbpnlcajy-uhfffaoysa-l}} | ||
| + | {{#set: molecular-weight=422.288}} | ||
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite THIAMINE-PYROPHOSPHATE
- common-name:
- thiamine diphosphate
- smiles:
- cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
- inchi-key:
- ayekofbpnlcajy-uhfffaoysa-l
- molecular-weight:
- 422.288
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
- PDHam2hi
- PDHam2mi
- RXN-12508
- RXN-14037
- RXN0-3542
- THIAMIN-PYROPHOSPHOKINASE-RXN
- THIAMIN-TRIPHOSPHATASE-RXN
