|
|
| (9 intermediate revisions by 5 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALPHAGALACTOSID-RXN ALPHAGALACTOSID-RXN] == | + | == Metabolite THIAMINE-PYROPHOSPHATE == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** alpha-galactosidase | + | ** thiamine diphosphate |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/3.2.1.22 ec-3.2.1.22] | + | ** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2)) |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[MELIBIOSE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[D-galactopyranose]][c] '''+''' 1 [[Glucopyranose]][c]
| + | ** ayekofbpnlcajy-uhfffaoysa-l |
| − | == Gene(s) associated with this reaction == | + | * molecular-weight: |
| − | * Gene: [[SJ03511]] | + | ** 422.288 |
| − | ** Category: [[orthology]] | + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | * [[RXN-12583]] |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | * [[RXN-14037]] |
| − | * Gene: [[SJ02145]]
| + | * [[RXN0-3542]] |
| − | ** Category: [[orthology]]
| + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | * [[PDHam2hi]] |
| − | * Gene: [[SJ02144]]
| + | * [[PDHam2mi]] |
| − | ** Category: [[annotation]]
| + | * [[RXN-12508]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| + | * [[RXN-14037]] |
| − | * Gene: [[SJ05258]] | + | * [[RXN0-3542]] |
| − | ** Category: [[annotation]]
| + | * [[THIAMIN-PYROPHOSPHOKINASE-RXN]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| + | * [[THIAMIN-TRIPHOSPHATASE-RXN]] |
| − | ** Category: [[orthology]] | + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: common-name=thiamine diphosphate}} |
| − | == Pathway(s) == | + | {{#set: inchi-key=inchikey=ayekofbpnlcajy-uhfffaoysa-l}} |
| − | * [[PWY0-1301]], melibiose degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1301 PWY0-1301] | + | {{#set: molecular-weight=422.288}} |
| − | ** '''1''' reactions found over '''1''' reactions in the full pathway | |
| − | == Reconstruction information ==
| |
| − | * category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | == External links == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R01101 R01101]
| |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=28663 28663]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P16551 P16551]
| |
| − | ** [http://www.uniprot.org/uniprot/P27756 P27756]
| |
| − | ** [http://www.uniprot.org/uniprot/P04824 P04824]
| |
| − | ** [http://www.uniprot.org/uniprot/P06720 P06720]
| |
| − | ** [http://www.uniprot.org/uniprot/P06280 P06280]
| |
| − | ** [http://www.uniprot.org/uniprot/P51569 P51569]
| |
| − | ** [http://www.uniprot.org/uniprot/O93816 O93816]
| |
| − | ** [http://www.uniprot.org/uniprot/Q03647 Q03647]
| |
| − | ** [http://www.uniprot.org/uniprot/P14749 P14749]
| |
| − | ** [http://www.uniprot.org/uniprot/P28351 P28351]
| |
| − | ** [http://www.uniprot.org/uniprot/P43467 P43467]
| |
| − | ** [http://www.uniprot.org/uniprot/Q99172 Q99172]
| |
| − | ** [http://www.uniprot.org/uniprot/P41945 P41945]
| |
| − | ** [http://www.uniprot.org/uniprot/P41946 P41946]
| |
| − | ** [http://www.uniprot.org/uniprot/P41947 P41947]
| |
| − | ** [http://www.uniprot.org/uniprot/Q92457 Q92457]
| |
| − | ** [http://www.uniprot.org/uniprot/Q92456 Q92456]
| |
| − | ** [http://www.uniprot.org/uniprot/Q92451 Q92451]
| |
| − | ** [http://www.uniprot.org/uniprot/O04943 O04943]
| |
| − | ** [http://www.uniprot.org/uniprot/O04944 O04944]
| |
| − | ** [http://www.uniprot.org/uniprot/Q39811 Q39811]
| |
| − | ** [http://www.uniprot.org/uniprot/Q41100 Q41100]
| |
| − | ** [http://www.uniprot.org/uniprot/Q42656 Q42656]
| |
| − | </div>
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=alpha-galactosidase}} | |
| − | {{#set: ec-number=ec-3.2.1.22}} | |
| − | {{#set: nb gene associated=4}} | |
| − | {{#set: nb pathway associated=1}}
| |
| − | {{#set: reconstruction category=orthology|annotation}}
| |
| − | {{#set: reconstruction tool=pathwaytools|pantograph}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_arabidopsis_thaliana|output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
| |
