Difference between revisions of "THIAMINE-PYROPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-4 == * common-name: ** (3s,5r,6r)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al * smiles: ** cc(=cc=cc=c(c)...")
(Created page with "Category:metabolite == Metabolite Oligomers-Of-16beta-D-Glucans == * common-name: ** a (1→6)-β-linked oligosaccharide == Reaction(s) known to consume the compoun...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD1F-4 ==
+
== Metabolite Oligomers-Of-16beta-D-Glucans ==
 
* common-name:
 
* common-name:
** (3s,5r,6r)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al
+
** a (1→6)-β-linked oligosaccharide
* smiles:
 
** cc(=cc=cc=c(c)c=o)c=cc=c(c)c=c=c1(c(o)(c)cc(o)cc(c)(c)1)
 
* inchi-key:
 
** mfdugtooxgorrx-orglzdqcsa-n
 
* molecular-weight:
 
** 382.542
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-698]]
+
* [[3.2.1.75-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3s,5r,6r)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al}}
+
{{#set: common-name=a (1→6)-β-linked oligosaccharide}}
{{#set: inchi-key=inchikey=mfdugtooxgorrx-orglzdqcsa-n}}
 
{{#set: molecular-weight=382.542}}
 

Revision as of 15:31, 5 January 2021

Metabolite Oligomers-Of-16beta-D-Glucans

  • common-name:
    • a (1→6)-β-linked oligosaccharide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality