Difference between revisions of "THIOCYSTEINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite C4 == * common-name: ** undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanyl-d-alanine * smiles: ** cc(c...")
(Created page with "Category:metabolite == Metabolite PYRIDOXAMINE == * common-name: ** pyridoxamine * smiles: ** cc1(=nc=c(co)c(c[n+])=c(o)1) * inchi-key: ** nhzmqxzhnvqtqa-uhfffaoysa-o * mo...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite C4 ==
+
== Metabolite PYRIDOXAMINE ==
 
* common-name:
 
* common-name:
** undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanyl-d-alanine
+
** pyridoxamine
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(=o)(op(=o)([o-])oc1(oc(co)c(o)c(oc(c)c(=o)nc(c)c(=o)nc(ccc(nc(cccc[n+])c(=o)nc(c)c(nc(c(=o)[o-])c)=o)=o)c([o-])=o)c(nc(c)=o)1))[o-])c)c)c)c)c)c)c
+
** cc1(=nc=c(co)c(c[n+])=c(o)1)
 
* inchi-key:
 
* inchi-key:
** sulooaflxmqjsf-ogdyfqgpsa-k
+
** nhzmqxzhnvqtqa-uhfffaoysa-o
 
* molecular-weight:
 
* molecular-weight:
** 1670.034
+
** 169.203
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8975]]
+
* [[PYRAMKIN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8975]]
+
* [[PYAMPP]]
 +
* [[RXN-14046]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanyl-d-alanine}}
+
{{#set: common-name=pyridoxamine}}
{{#set: inchi-key=inchikey=sulooaflxmqjsf-ogdyfqgpsa-k}}
+
{{#set: inchi-key=inchikey=nhzmqxzhnvqtqa-uhfffaoysa-o}}
{{#set: molecular-weight=1670.034}}
+
{{#set: molecular-weight=169.203}}

Revision as of 08:30, 15 March 2021

Metabolite PYRIDOXAMINE

  • common-name:
    • pyridoxamine
  • smiles:
    • cc1(=nc=c(co)c(c[n+])=c(o)1)
  • inchi-key:
    • nhzmqxzhnvqtqa-uhfffaoysa-o
  • molecular-weight:
    • 169.203

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality