Difference between revisions of "THIOMORPHOLINE-3-CARBOXYLATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10712 == * common-name: ** di-trans, poly-cis-polyprenyl diphosphate (c80) * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)...")
(Created page with "Category:metabolite == Metabolite THIOMORPHOLINE-3-CARBOXYLATE == * common-name: ** thiomorpholine-3-carboxylate * smiles: ** c1(scc(c([o-])=o)[n+]c1) * inchi-key: ** joki...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-10712 ==
+
== Metabolite THIOMORPHOLINE-3-CARBOXYLATE ==
 
* common-name:
 
* common-name:
** di-trans, poly-cis-polyprenyl diphosphate (c80)
+
** thiomorpholine-3-carboxylate
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])(=o)[o-]
+
** c1(scc(c([o-])=o)[n+]c1)
 
* inchi-key:
 
* inchi-key:
** tunipipdjadhsr-hiqrjctmsa-k
+
** jokiqgqokxghdv-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 1264.842
+
** 147.192
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9969]]
+
* [[1.5.1.25-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=di-trans, poly-cis-polyprenyl diphosphate (c80)}}
+
{{#set: common-name=thiomorpholine-3-carboxylate}}
{{#set: inchi-key=inchikey=tunipipdjadhsr-hiqrjctmsa-k}}
+
{{#set: inchi-key=inchikey=jokiqgqokxghdv-uhfffaoysa-n}}
{{#set: molecular-weight=1264.842}}
+
{{#set: molecular-weight=147.192}}

Latest revision as of 11:11, 18 March 2021

Metabolite THIOMORPHOLINE-3-CARBOXYLATE

  • common-name:
    • thiomorpholine-3-carboxylate
  • smiles:
    • c1(scc(c([o-])=o)[n+]c1)
  • inchi-key:
    • jokiqgqokxghdv-uhfffaoysa-n
  • molecular-weight:
    • 147.192

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality