Difference between revisions of "THIOMORPHOLINE-3-CARBOXYLATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MAL == * common-name: ** (s)-malate * smiles: ** c(=o)([o-])cc(o)c([o-])=o * inchi-key: ** bjepykjpyrnkow-reohclbhsa-l * molecular-weight...") |
(Created page with "Category:metabolite == Metabolite THIOMORPHOLINE-3-CARBOXYLATE == * common-name: ** thiomorpholine-3-carboxylate * smiles: ** c1(scc(c([o-])=o)[n+]c1) * inchi-key: ** joki...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite THIOMORPHOLINE-3-CARBOXYLATE == |
* common-name: | * common-name: | ||
− | ** | + | ** thiomorpholine-3-carboxylate |
* smiles: | * smiles: | ||
− | ** c | + | ** c1(scc(c([o-])=o)[n+]c1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** jokiqgqokxghdv-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 147.192 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[1.5.1.25-RXN]] |
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=thiomorpholine-3-carboxylate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jokiqgqokxghdv-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=147.192}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite THIOMORPHOLINE-3-CARBOXYLATE
- common-name:
- thiomorpholine-3-carboxylate
- smiles:
- c1(scc(c([o-])=o)[n+]c1)
- inchi-key:
- jokiqgqokxghdv-uhfffaoysa-n
- molecular-weight:
- 147.192