Difference between revisions of "THIOREDOX-PWY"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-D-GALACTOSE ALPHA-D-GALACTOSE] ==
+== Pathway THIOREDOX-PWY ==
+* taxonomic-range:
+** tax-2759
+** tax-2
+** tax-2157
 * common-name:
-** &alpha;-d-galactose
+** thioredoxin pathway
-* smiles:
+== Reaction(s) found ==
-** c(o)c1(oc(o)c(o)c(o)c(o)1)
+* [[THIOREDOXIN-REDUCT-NADPH-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** wqzgkkkjijffok-phyprbdbsa-n
+* [NoneTHIOREDOXIN-RXN THIOREDOXIN-RXN]
-* molecular-weight:
+{{#set: taxonomic-range=tax-2|tax-2157|tax-2759}}
-** 180.157
+{{#set: common-name=thioredoxin pathway}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[ALDOSE1EPIM-RXN]]
+{{#set: completion rate=0.5}}
-* [[GALACTOKIN-RXN]]
+{{#set: nb total reaction=2}}
-== Reaction(s) known to produce the compound ==
-* [[ALDOSE1EPIM-RXN]]
-* [[GALACTOKIN-RXN]]
-* [[RXN-11501]]
-* [[RXN-11502]]
-* [[RXN-12088]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=&alpha;-d-galactose}}
-{{#set: inchi-key=inchikey=wqzgkkkjijffok-phyprbdbsa-n}}
-{{#set: molecular-weight=180.157}}