Difference between revisions of "THIOREDOX-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Glucosyl-acyl-sphingosines Glucosyl-acyl-sphingosines] == * common-name: ** a β-d-glucosyl...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-D-GALACTOSE ALPHA-D-GALACTOSE] == * common-name: ** α-d-galactose * smiles: ** c(o)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Glucosyl-acyl-sphingosines Glucosyl-acyl-sphingosines] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-D-GALACTOSE ALPHA-D-GALACTOSE] ==
 
* common-name:
 
* common-name:
** a β-d-glucosyl-n-acylsphingosine
+
** α-d-galactose
 +
* smiles:
 +
** c(o)c1(oc(o)c(o)c(o)c(o)1)
 +
* inchi-key:
 +
** wqzgkkkjijffok-phyprbdbsa-n
 +
* molecular-weight:
 +
** 180.157
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLUCOSYLCERAMIDASE-RXN]]
+
* [[ALDOSE1EPIM-RXN]]
 +
* [[GALACTOKIN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ALDOSE1EPIM-RXN]]
 +
* [[GALACTOKIN-RXN]]
 +
* [[RXN-11501]]
 +
* [[RXN-11502]]
 +
* [[RXN-12088]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a β-d-glucosyl-n-acylsphingosine}}
+
{{#set: common-name=α-d-galactose}}
 +
{{#set: inchi-key=inchikey=wqzgkkkjijffok-phyprbdbsa-n}}
 +
{{#set: molecular-weight=180.157}}

Revision as of 09:22, 27 August 2019

Metabolite ALPHA-D-GALACTOSE

  • common-name:
    • α-d-galactose
  • smiles:
    • c(o)c1(oc(o)c(o)c(o)c(o)1)
  • inchi-key:
    • wqzgkkkjijffok-phyprbdbsa-n
  • molecular-weight:
    • 180.157

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality