Difference between revisions of "THIOREDOX-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-D-GALACTOSE ALPHA-D-GALACTOSE] == * common-name: ** α-d-galactose * smiles: ** c(o)...")
(Created page with "Category:pathway == Pathway PWY-6969 == * taxonomic-range: ** tax-1117 ** tax-3035 ** tax-1224 ** tax-201174 * common-name: ** tca cycle v (2-oxoglutarate:ferredoxin oxido...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-D-GALACTOSE ALPHA-D-GALACTOSE] ==
+
== Pathway PWY-6969 ==
 +
* taxonomic-range:
 +
** tax-1117
 +
** tax-3035
 +
** tax-1224
 +
** tax-201174
 
* common-name:
 
* common-name:
** α-d-galactose
+
** tca cycle v (2-oxoglutarate:ferredoxin oxidoreductase)
* smiles:
+
== Reaction(s) found ==
** c(o)c1(oc(o)c(o)c(o)c(o)1)
+
* [[ACONITATEDEHYDR-RXN]]
* inchi-key:
+
* [[ACONITATEHYDR-RXN]]
** wqzgkkkjijffok-phyprbdbsa-n
+
* [[CITSYN-RXN]]
* molecular-weight:
+
* [[FUMHYDR-RXN]]
** 180.157
+
* [[ISOCIT-CLEAV-RXN]]
== Reaction(s) known to consume the compound ==
+
* [[ISOCITDEH-RXN]]
* [[ALDOSE1EPIM-RXN]]
+
* [[MALATE-DEH-RXN]]
* [[GALACTOKIN-RXN]]
+
* [[MALSYN-RXN]]
== Reaction(s) known to produce the compound ==
+
* [[RXN-14971]]
* [[ALDOSE1EPIM-RXN]]
+
* [[SUCCCOASYN-RXN]]
* [[GALACTOKIN-RXN]]
+
== Reaction(s) not found ==
* [[RXN-11501]]
+
* [NoneRXN-12912 RXN-12912]
* [[RXN-11502]]
+
* [None2-OXOGLUTARATE-SYNTHASE-RXN 2-OXOGLUTARATE-SYNTHASE-RXN]
* [[RXN-12088]]
+
{{#set: taxonomic-range=tax-1224|tax-3035|tax-201174|tax-1117}}
== Reaction(s) of unknown directionality ==
+
{{#set: common-name=tca cycle v (2-oxoglutarate:ferredoxin oxidoreductase)}}
{{#set: common-name=α-d-galactose}}
+
{{#set: nb reaction found=10}}
{{#set: inchi-key=inchikey=wqzgkkkjijffok-phyprbdbsa-n}}
+
{{#set: completion rate=0.83}}
{{#set: molecular-weight=180.157}}
+
{{#set: nb total reaction=12}}

Revision as of 20:15, 18 December 2020

Pathway PWY-6969

  • taxonomic-range:
    • tax-1117
    • tax-3035
    • tax-1224
    • tax-201174
  • common-name:
    • tca cycle v (2-oxoglutarate:ferredoxin oxidoreductase)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-12912 RXN-12912]
  • [None2-OXOGLUTARATE-SYNTHASE-RXN 2-OXOGLUTARATE-SYNTHASE-RXN]