Difference between revisions of "THR-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ01128 == * transcription-direction: ** positive * right-end-position: ** 892142 * left-end-position: ** 880328 * centisome-position: ** 79.45564...") |
(Created page with "Category:metabolite == Metabolite GLYCEROPHOSPHOGLYCEROL == * common-name: ** glycerophosphoglycerol * smiles: ** c(c(cop(occ(co)o)([o-])=o)o)o * inchi-key: ** llcsxhmjulh...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite GLYCEROPHOSPHOGLYCEROL == |
| − | * | + | * common-name: |
| − | ** | + | ** glycerophosphoglycerol |
| − | * | + | * smiles: |
| − | ** | + | ** c(c(cop(occ(co)o)([o-])=o)o)o |
| − | * | + | * inchi-key: |
| − | ** | + | ** llcsxhmjulhsjn-uhfffaoysa-m |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 245.146 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-14073]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=glycerophosphoglycerol}} | |
| − | + | {{#set: inchi-key=inchikey=llcsxhmjulhsjn-uhfffaoysa-m}} | |
| − | + | {{#set: molecular-weight=245.146}} | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Revision as of 20:30, 18 December 2020
Contents
Metabolite GLYCEROPHOSPHOGLYCEROL
- common-name:
- glycerophosphoglycerol
- smiles:
- c(c(cop(occ(co)o)([o-])=o)o)o
- inchi-key:
- llcsxhmjulhsjn-uhfffaoysa-m
- molecular-weight:
- 245.146
