Difference between revisions of "THREO-DS-ISO-CITRATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ05976 == * transcription-direction: ** positive * right-end-position: ** 72547 * left-end-position: ** 66817 * centisome-position: ** 77.995285...")
(Created page with "Category:metabolite == Metabolite THREO-DS-ISO-CITRATE == * common-name: ** d-threo-isocitrate * smiles: ** c(=o)(c(cc([o-])=o)c(o)c([o-])=o)[o-] * inchi-key: ** odblhexud...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ05976 ==
+
== Metabolite THREO-DS-ISO-CITRATE ==
* transcription-direction:
+
* common-name:
** positive
+
** d-threo-isocitrate
* right-end-position:
+
* smiles:
** 72547
+
** c(=o)(c(cc([o-])=o)c(o)c([o-])=o)[o-]
* left-end-position:
+
* inchi-key:
** 66817
+
** odblhexudapzau-zafykaaxsa-k
* centisome-position:
+
* molecular-weight:
** 77.995285   
+
** 189.101
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[ACONITATEHYDR-RXN]]
== Reaction(s) associated ==
+
* [[ISOCIT-CLEAV-RXN]]
* [[HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN]]
+
* [[ISOCITDEH-RXN]]
** Category: [[annotation]]
+
* [[RXN-14047]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-9951]]
** Category: [[orthology]]
+
* [[biomass_rxn]]
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
{{#set: transcription-direction=positive}}
+
* [[ACONITATEHYDR-RXN]]
{{#set: right-end-position=72547}}
+
* [[ISOCIT-CLEAV-RXN]]
{{#set: left-end-position=66817}}
+
* [[ISOCITDEH-RXN]]
{{#set: centisome-position=77.995285    }}
+
* [[RXN-14047]]
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[RXN-9951]]
{{#set: nb reaction associated=1}}
+
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=d-threo-isocitrate}}
 +
{{#set: inchi-key=inchikey=odblhexudapzau-zafykaaxsa-k}}
 +
{{#set: molecular-weight=189.101}}

Latest revision as of 11:12, 18 March 2021

Metabolite THREO-DS-ISO-CITRATE

  • common-name:
    • d-threo-isocitrate
  • smiles:
    • c(=o)(c(cc([o-])=o)c(o)c([o-])=o)[o-]
  • inchi-key:
    • odblhexudapzau-zafykaaxsa-k
  • molecular-weight:
    • 189.101

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality