Difference between revisions of "THYMIDINE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ10933 == * transcription-direction: ** negative * right-end-position: ** 21509 * left-end-position: ** 20970 * centisome-position: ** 85.10897...") |
(Created page with "Category:metabolite == Metabolite THYMIDINE == * common-name: ** thymidine * smiles: ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(co)o2)) * inchi-key: ** iqfyykkmvgjfeh-xlpzgreqsa-n...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite THYMIDINE == |
| − | * | + | * common-name: |
| − | ** | + | ** thymidine |
| − | * | + | * smiles: |
| − | ** | + | ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(co)o2)) |
| − | * | + | * inchi-key: |
| − | ** | + | ** iqfyykkmvgjfeh-xlpzgreqsa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 242.231 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | * [[TPH]] |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=thymidine}} | |
| − | + | {{#set: inchi-key=inchikey=iqfyykkmvgjfeh-xlpzgreqsa-n}} | |
| − | {{#set: | + | {{#set: molecular-weight=242.231}} |
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite THYMIDINE
- common-name:
- thymidine
- smiles:
- cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(co)o2))
- inchi-key:
- iqfyykkmvgjfeh-xlpzgreqsa-n
- molecular-weight:
- 242.231
