Difference between revisions of "THYMINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GDP-TP == * common-name: ** pppgpp * smiles: ** c(op([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])c1(oc(c(o)c(op([o-])(=o)op(o)([o-])=o)1)n3(c=n...")
(Created page with "Category:metabolite == Metabolite THYMINE == * common-name: ** thymine * smiles: ** cc1(c(=o)nc(nc=1)=o) * inchi-key: ** rwqnbrdokxibiv-uhfffaoysa-n * molecular-weight: **...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GDP-TP ==
+
== Metabolite THYMINE ==
 
* common-name:
 
* common-name:
** pppgpp
+
** thymine
 
* smiles:
 
* smiles:
** c(op([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])c1(oc(c(o)c(op([o-])(=o)op(o)([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
+
** cc1(c(=o)nc(nc=1)=o)
 
* inchi-key:
 
* inchi-key:
** kcpmacxzaitqax-uuokfmhzsa-h
+
** rwqnbrdokxibiv-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 677.095
+
** 126.115
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-6427]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GTPPYPHOSKIN-RXN]]
+
* [[RXN-11049]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pppgpp}}
+
{{#set: common-name=thymine}}
{{#set: inchi-key=inchikey=kcpmacxzaitqax-uuokfmhzsa-h}}
+
{{#set: inchi-key=inchikey=rwqnbrdokxibiv-uhfffaoysa-n}}
{{#set: molecular-weight=677.095}}
+
{{#set: molecular-weight=126.115}}

Latest revision as of 11:11, 18 March 2021

Metabolite THYMINE

  • common-name:
    • thymine
  • smiles:
    • cc1(c(=o)nc(nc=1)=o)
  • inchi-key:
    • rwqnbrdokxibiv-uhfffaoysa-n
  • molecular-weight:
    • 126.115

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality