Difference between revisions of "THYMINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17047 == * common-name: ** 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine * smiles: ** c(sc2(cc1(=cc=cc=c1))...") |
(Created page with "Category:metabolite == Metabolite CPD-16953 == * common-name: ** 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin * smiles: ** cc2(c(c(c)o)=nc1(c(=o)nc(n)=nc=1n2)) *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-16953 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin |
* smiles: | * smiles: | ||
| − | ** c( | + | ** cc2(c(c(c)o)=nc1(c(=o)nc(n)=nc=1n2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ghrbcdhnysufrn-iuyqgcfvsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 223.234 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-15733]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ghrbcdhnysufrn-iuyqgcfvsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=223.234}} |
Revision as of 13:08, 14 January 2021
Contents
Metabolite CPD-16953
- common-name:
- 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin
- smiles:
- cc2(c(c(c)o)=nc1(c(=o)nc(n)=nc=1n2))
- inchi-key:
- ghrbcdhnysufrn-iuyqgcfvsa-n
- molecular-weight:
- 223.234
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
