Difference between revisions of "THZ-P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PYRIDOXAMINE == * common-name: ** pyridoxamine * smiles: ** cc1(=nc=c(co)c(c[n+])=c(o)1) * inchi-key: ** nhzmqxzhnvqtqa-uhfffaoysa-o * mo...") |
(Created page with "Category:metabolite == Metabolite THZ-P == * common-name: ** 4-methyl-5-(2-phosphooxyethyl)thiazole * smiles: ** cc1(n=csc(ccop([o-])(=o)[o-])=1) * inchi-key: ** ocymerzcm...") |
||
| (5 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite THZ-P == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-methyl-5-(2-phosphooxyethyl)thiazole |
* smiles: | * smiles: | ||
| − | ** cc1(= | + | ** cc1(n=csc(ccop([o-])(=o)[o-])=1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ocymerzcmyjqqo-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 221.167 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[THI-P-SYN-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[THIAZOLSYN3-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-methyl-5-(2-phosphooxyethyl)thiazole}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ocymerzcmyjqqo-uhfffaoysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=221.167}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite THZ-P
- common-name:
- 4-methyl-5-(2-phosphooxyethyl)thiazole
- smiles:
- cc1(n=csc(ccop([o-])(=o)[o-])=1)
- inchi-key:
- ocymerzcmyjqqo-uhfffaoysa-l
- molecular-weight:
- 221.167
