Difference between revisions of "TMP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8607 == * common-name: ** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol * smiles: ** cc(c)cccc([ch]4(c1(c)(c...") |
(Created page with "Category:metabolite == Metabolite CPD-7088 == * common-name: ** (2r,3s,4s)-leucodelphinidin * smiles: ** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc(o)=c(c(o)=3)o) * inchi-ke...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-7088 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (2r,3s,4s)-leucodelphinidin |
* smiles: | * smiles: | ||
| − | ** | + | ** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc(o)=c(c(o)=3)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zeacokjoqlaytd-souvjxgzsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 322.271 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-7784]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(2r,3s,4s)-leucodelphinidin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zeacokjoqlaytd-souvjxgzsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=322.271}} |
Revision as of 11:13, 15 January 2021
Contents
Metabolite CPD-7088
- common-name:
- (2r,3s,4s)-leucodelphinidin
- smiles:
- c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc(o)=c(c(o)=3)o)
- inchi-key:
- zeacokjoqlaytd-souvjxgzsa-n
- molecular-weight:
- 322.271
