Difference between revisions of "TMP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7088 == * common-name: ** (2r,3s,4s)-leucodelphinidin * smiles: ** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc(o)=c(c(o)=3)o) * inchi-ke...")
(Created page with "Category:metabolite == Metabolite CPD-9965 == * common-name: ** icosanoyl-coa * smiles: ** cccccccccccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7088 ==
+
== Metabolite CPD-9965 ==
 
* common-name:
 
* common-name:
** (2r,3s,4s)-leucodelphinidin
+
** icosanoyl-coa
 
* smiles:
 
* smiles:
** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc(o)=c(c(o)=3)o)
+
** cccccccccccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** zeacokjoqlaytd-souvjxgzsa-n
+
** jylsvnbjlycssw-ibyujnrcsa-j
 
* molecular-weight:
 
* molecular-weight:
** 322.271
+
** 1058.022
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-13295]]
 +
* [[RXN-9356]]
 +
* [[RXN-9629]]
 +
* [[RXN1G-460]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7784]]
+
* [[RXN-9356]]
 +
* [[RXN1G-460]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2r,3s,4s)-leucodelphinidin}}
+
{{#set: common-name=icosanoyl-coa}}
{{#set: inchi-key=inchikey=zeacokjoqlaytd-souvjxgzsa-n}}
+
{{#set: inchi-key=inchikey=jylsvnbjlycssw-ibyujnrcsa-j}}
{{#set: molecular-weight=322.271}}
+
{{#set: molecular-weight=1058.022}}

Revision as of 08:24, 15 March 2021

Metabolite CPD-9965

  • common-name:
    • icosanoyl-coa
  • smiles:
    • cccccccccccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • jylsvnbjlycssw-ibyujnrcsa-j
  • molecular-weight:
    • 1058.022

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality