Difference between revisions of "TMP"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ13002 == * transcription-direction: ** positive * right-end-position: ** 84470 * left-end-position: ** 61178 * centisome-position: ** 8.258826...") |
(Created page with "Category:metabolite == Metabolite TMP == * common-name: ** dtmp * smiles: ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])[o-])o2)) * inchi-key: ** gyozywvxfndglu-xlpzgreqs...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite TMP == |
− | * | + | * common-name: |
− | ** | + | ** dtmp |
− | * | + | * smiles: |
− | ** | + | ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])[o-])o2)) |
− | * | + | * inchi-key: |
− | ** | + | ** gyozywvxfndglu-xlpzgreqsa-l |
− | * | + | * molecular-weight: |
− | ** | + | ** 320.195 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[ATDTM]] |
− | + | * [[DTMPKI-RXN]] | |
− | * [[ | + | * [[MDUMT]] |
− | * | + | * [[TPH]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | * [[ | + | * [[MDUMT]] |
− | * | + | * [[RXN-14200]] |
− | * | + | * [[RXN-14213]] |
− | {{#set: | + | * [[RXN0-5107]] |
− | {{#set: | + | * [[THYMIDYLATESYN-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | {{#set: | + | {{#set: common-name=dtmp}} |
− | + | {{#set: inchi-key=inchikey=gyozywvxfndglu-xlpzgreqsa-l}} | |
− | + | {{#set: molecular-weight=320.195}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite TMP
- common-name:
- dtmp
- smiles:
- cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])[o-])o2))
- inchi-key:
- gyozywvxfndglu-xlpzgreqsa-l
- molecular-weight:
- 320.195