|
|
| (7 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:gene]] | + | [[Category:metabolite]] |
| − | == Gene SJ08678 == | + | == Metabolite TMP == |
| − | * transcription-direction: | + | * common-name: |
| − | ** positive | + | ** dtmp |
| − | * right-end-position: | + | * smiles: |
| − | ** 24938 | + | ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])[o-])o2)) |
| − | * left-end-position:
| + | * inchi-key: |
| − | ** 14666
| + | ** gyozywvxfndglu-xlpzgreqsa-l |
| − | * centisome-position:
| + | * molecular-weight: |
| − | ** 28.898521
| + | ** 320.195 |
| − | == Organism(s) associated with this gene == | + | == Reaction(s) known to consume the compound == |
| − | * [[S.japonica_carotenoid_curated]]
| + | * [[ATDTM]] |
| − | == Reaction(s) associated ==
| + | * [[DTMPKI-RXN]] |
| − | * [[ASPAMINOTRANS-RXN]]
| + | * [[MDUMT]] |
| − | ** Category: [[orthology]]
| + | * [[TPH]] |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| + | == Reaction(s) known to produce the compound == |
| − | * [[PHEAMINOTRANS-RXN]]
| + | * [[MDUMT]] |
| − | ** Category: [[orthology]] | + | * [[RXN-14200]] |
| − | *** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| + | * [[RXN-14213]] |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| + | * [[RXN0-5107]] |
| − | * [[RXN-10814]]
| + | * [[THYMIDYLATESYN-RXN]] |
| − | ** Category: [[orthology]]
| + | == Reaction(s) of unknown directionality == |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | + | {{#set: common-name=dtmp}} |
| − | * [[RXN-11737]]
| + | {{#set: inchi-key=inchikey=gyozywvxfndglu-xlpzgreqsa-l}} |
| − | ** Category: [[orthology]]
| + | {{#set: molecular-weight=320.195}} |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-13697]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[SUCCINYLDIAMINOPIMTRANS-RXN]] | |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | == Pathway(s) associated == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * [[ASPARAGINE-DEG1-PWY-1]] | |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[ASPARTATESYN-PWY]] | |
| − | ** '''1''' reactions found over '''1''' reactions in the full pathway
| |
| − | * [[GLUTDEG-PWY]] | |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-5913]] | |
| − | ** '''10''' reactions found over '''11''' reactions in the full pathway
| |
| − | * [[PWY-7383]] | |
| − | ** '''4''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY-7117]] | |
| − | ** '''10''' reactions found over '''12''' reactions in the full pathway
| |
| − | * [[PWY-7115]]
| |
| − | ** '''9''' reactions found over '''10''' reactions in the full pathway
| |
| − | * [[ASPARTATE-DEG1-PWY]] | |
| − | ** '''1''' reactions found over '''1''' reactions in the full pathway
| |
| − | * [[MALATE-ASPARTATE-SHUTTLE-PWY]] | |
| − | ** '''2''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[ANAPHENOXI-PWY]] | |
| − | ** '''1''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PHESYN]]
| |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-7432]]
| |
| − | ** '''3''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-5079]]
| |
| − | ** '''2''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-6318]]
| |
| − | ** '''4''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-6638]]
| |
| − | ** '''1''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-6642]]
| |
| − | ** '''2''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-6643]]
| |
| − | ** '''1''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[DAPLYSINESYN-PWY]]
| |
| − | ** '''7''' reactions found over '''9''' reactions in the full pathway
| |
| − | </div>
| |
| − | {{#set: transcription-direction=positive}} | |
| − | {{#set: right-end-position=24938}} | |
| − | {{#set: left-end-position=14666}}
| |
| − | {{#set: centisome-position=28.898521 }} | |
| − | {{#set: organism associated=S.japonica_carotenoid_curated}}
| |
| − | {{#set: nb reaction associated=6}}
| |
| − | {{#set: nb pathway associated=18}}
| |
