Difference between revisions of "TMP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Cleaved-Angiotensinogen == * common-name: ** a cleaved angiotensinogen == Reaction(s) known to consume the compound == == Reaction(s) kno...")
(Created page with "Category:metabolite == Metabolite TMP == * common-name: ** dtmp * smiles: ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])[o-])o2)) * inchi-key: ** gyozywvxfndglu-xlpzgreqs...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Cleaved-Angiotensinogen ==
+
== Metabolite TMP ==
 
* common-name:
 
* common-name:
** a cleaved angiotensinogen
+
** dtmp
 +
* smiles:
 +
** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])[o-])o2))
 +
* inchi-key:
 +
** gyozywvxfndglu-xlpzgreqsa-l
 +
* molecular-weight:
 +
** 320.195
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ATDTM]]
 +
* [[DTMPKI-RXN]]
 +
* [[MDUMT]]
 +
* [[TPH]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.4.23.15-RXN]]
+
* [[MDUMT]]
 +
* [[RXN-14200]]
 +
* [[RXN-14213]]
 +
* [[RXN0-5107]]
 +
* [[THYMIDYLATESYN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a cleaved angiotensinogen}}
+
{{#set: common-name=dtmp}}
 +
{{#set: inchi-key=inchikey=gyozywvxfndglu-xlpzgreqsa-l}}
 +
{{#set: molecular-weight=320.195}}

Latest revision as of 11:11, 18 March 2021

Metabolite TMP

  • common-name:
    • dtmp
  • smiles:
    • cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])[o-])o2))
  • inchi-key:
    • gyozywvxfndglu-xlpzgreqsa-l
  • molecular-weight:
    • 320.195

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality