Difference between revisions of "TMP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLUCOSAMINYL-14-ETCETERA-MANNOSYL-R == * common-name: ** n-acetyl-β-d-glucosaminyl-1,4-(n-acetyl-d-glucosaminyl-1,2)-α-d-manno...") |
(Created page with "Category:metabolite == Metabolite TMP == * common-name: ** dtmp * smiles: ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])[o-])o2)) * inchi-key: ** gyozywvxfndglu-xlpzgreqs...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite TMP == |
* common-name: | * common-name: | ||
− | ** | + | ** dtmp |
+ | * smiles: | ||
+ | ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])[o-])o2)) | ||
+ | * inchi-key: | ||
+ | ** gyozywvxfndglu-xlpzgreqsa-l | ||
+ | * molecular-weight: | ||
+ | ** 320.195 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[ATDTM]] |
+ | * [[DTMPKI-RXN]] | ||
+ | * [[MDUMT]] | ||
+ | * [[TPH]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[MDUMT]] |
+ | * [[RXN-14200]] | ||
+ | * [[RXN-14213]] | ||
+ | * [[RXN0-5107]] | ||
+ | * [[THYMIDYLATESYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=dtmp}} |
+ | {{#set: inchi-key=inchikey=gyozywvxfndglu-xlpzgreqsa-l}} | ||
+ | {{#set: molecular-weight=320.195}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite TMP
- common-name:
- dtmp
- smiles:
- cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])[o-])o2))
- inchi-key:
- gyozywvxfndglu-xlpzgreqsa-l
- molecular-weight:
- 320.195