Difference between revisions of "TMP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite TMP == * common-name: ** dtmp * smiles: ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])[o-])o2)) * inchi-key: ** gyozywvxfndglu-xlpzgreqs...")
(Created page with "Category:metabolite == Metabolite Chondroitin-N-acetyl-galactosamines == * common-name: ** [chondroitin]-n-acetyl-galactosamine == Reaction(s) known to consume the compoun...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite TMP ==
+
== Metabolite Chondroitin-N-acetyl-galactosamines ==
 
* common-name:
 
* common-name:
** dtmp
+
** [chondroitin]-n-acetyl-galactosamine
* smiles:
 
** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])[o-])o2))
 
* inchi-key:
 
** gyozywvxfndglu-xlpzgreqsa-l
 
* molecular-weight:
 
** 320.195
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ATDTM]]
+
* [[CHONDROITIN-4-SULFOTRANSFERASE-RXN]]
* [[DTMPKI-RXN]]
 
* [[MDUMT]]
 
* [[TPH]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[MDUMT]]
+
* [[3.1.6.12-RXN]]
* [[RXN-14200]]
 
* [[RXN-14213]]
 
* [[RXN0-5107]]
 
* [[THYMIDYLATESYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dtmp}}
+
{{#set: common-name=[chondroitin]-n-acetyl-galactosamine}}
{{#set: inchi-key=inchikey=gyozywvxfndglu-xlpzgreqsa-l}}
 
{{#set: molecular-weight=320.195}}
 

Revision as of 15:25, 5 January 2021

Metabolite Chondroitin-N-acetyl-galactosamines

  • common-name:
    • [chondroitin]-n-acetyl-galactosamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "chondroitin]-n-acetyl-galactosamine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.