Difference between revisions of "TRANS-3-METHYL-GLUTACONYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDROLIPOAMIDE == * common-name: ** dihydrolipoamide * smiles: ** c(ccc(n)=o)cc(s)ccs * inchi-key: ** vlyugyakyzetrf-ssdottswsa-n * mol...")
(Created page with "Category:metabolite == Metabolite TRANS-3-METHYL-GLUTACONYL-COA == * common-name: ** 3-methylglutaconyl-coa * smiles: ** cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DIHYDROLIPOAMIDE ==
+
== Metabolite TRANS-3-METHYL-GLUTACONYL-COA ==
 
* common-name:
 
* common-name:
** dihydrolipoamide
+
** 3-methylglutaconyl-coa
 
* smiles:
 
* smiles:
** c(ccc(n)=o)cc(s)ccs
+
** cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])cc(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** vlyugyakyzetrf-ssdottswsa-n
+
** gxkshrdahflwpn-rkylshmcsa-i
 
* molecular-weight:
 
* molecular-weight:
** 207.348
+
** 888.606
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[AKGDHe2r]]
 
* [[DIHYDLIPACETRANS-RXN]]
 
* [[PDHe3mr]]
 
* [[RXN-18331]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[AKGDHe2r]]
+
* [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]]
* [[DHRT_LPAREN_2mbcoa_RPAREN_]]
 
* [[DHRT_LPAREN_ibcoa_RPAREN_]]
 
* [[PDHe3mr]]
 
* [[RXN-18331]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dihydrolipoamide}}
+
{{#set: common-name=3-methylglutaconyl-coa}}
{{#set: inchi-key=inchikey=vlyugyakyzetrf-ssdottswsa-n}}
+
{{#set: inchi-key=inchikey=gxkshrdahflwpn-rkylshmcsa-i}}
{{#set: molecular-weight=207.348}}
+
{{#set: molecular-weight=888.606}}

Latest revision as of 11:17, 18 March 2021

Metabolite TRANS-3-METHYL-GLUTACONYL-COA

  • common-name:
    • 3-methylglutaconyl-coa
  • smiles:
    • cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])cc(=o)[o-]
  • inchi-key:
    • gxkshrdahflwpn-rkylshmcsa-i
  • molecular-weight:
    • 888.606

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality