Difference between revisions of "TRANS-3-METHYL-GLUTACONYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11356 RXN-11356] == * direction: ** left-to-right * common-name: ** 9,9'-di-cis-ζ-carotene...")
 
(Created page with "Category:metabolite == Metabolite TRANS-3-METHYL-GLUTACONYL-COA == * common-name: ** 3-methylglutaconyl-coa * smiles: ** cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11356 RXN-11356] ==
+
== Metabolite TRANS-3-METHYL-GLUTACONYL-COA ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** 9,9'-di-cis-ζ-carotene desaturase
+
** 3-methylglutaconyl-coa
* synonymous:
+
* smiles:
** ζ-carotene desaturase
+
** cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])cc(=o)[o-]
** zds
+
* inchi-key:
== Reaction formula ==
+
** gxkshrdahflwpn-rkylshmcsa-i
* 1 [[CPD-7526]][c] '''+''' 1 [[ETR-Quinones]][c] '''=>''' 1 [[CPD-7524]][c] '''+''' 1 [[ETR-Quinols]][c]
+
* molecular-weight:
== Gene(s) associated with this reaction  ==
+
** 888.606
* Gene: [[SJ05680]]
+
== Reaction(s) known to consume the compound ==
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]]
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: common-name=3-methylglutaconyl-coa}}
* Gene: [[SJ05681]]
+
{{#set: inchi-key=inchikey=gxkshrdahflwpn-rkylshmcsa-i}}
** Category: [[annotation]]
+
{{#set: molecular-weight=888.606}}
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
== Pathway(s) ==
 
* [[PWY-6475]], trans-lycopene biosynthesis II (oxygenic phototrophs and green sulfur bacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6475 PWY-6475]
 
** '''8''' reactions found over '''8''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30960 30960]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=9,9'-di-cis-ζ-carotene desaturase}}
 
{{#set: synonymous=ζ-carotene desaturase|zds}}
 
{{#set: nb gene associated=2}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=orthology|annotation}}
 
{{#set: reconstruction tool=pathwaytools|pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite TRANS-3-METHYL-GLUTACONYL-COA

  • common-name:
    • 3-methylglutaconyl-coa
  • smiles:
    • cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])cc(=o)[o-]
  • inchi-key:
    • gxkshrdahflwpn-rkylshmcsa-i
  • molecular-weight:
    • 888.606

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality