Difference between revisions of "TRANS-3-METHYL-GLUTACONYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13852 == * common-name: ** 2-hydroxy-damp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc(=o)n1)n)n=c2)))o3)o))op([o-])([o-])=o * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite CPD-8550 == * common-name: ** a substituted β-amino acid == Reaction(s) known to consume the compound == == Reaction(s) known to pro...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-8550 == |
* common-name: | * common-name: | ||
| − | ** | + | ** a substituted β-amino acid |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[BETA-LACTAMASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a substituted β-amino acid}} |
| − | |||
| − | |||
Revision as of 15:30, 5 January 2021
Contents
Metabolite CPD-8550
- common-name:
- a substituted β-amino acid
