Difference between revisions of "TRANS-D2-ENOYL-ACP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14018 == * common-name: ** icosapentaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(o...")
(Created page with "Category:metabolite == Metabolite TRANS-D2-ENOYL-ACP == * common-name: ** a trans-2-enoyl-[acyl-carrier protein] == Reaction(s) known to consume the compound == * 1.3.1....")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14018 ==
+
== Metabolite TRANS-D2-ENOYL-ACP ==
 
* common-name:
 
* common-name:
** icosapentaenoyl-coa
+
** a trans-2-enoyl-[acyl-carrier protein]
* smiles:
 
** ccc=ccc=ccc=ccc=ccc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** jwzlrycddxhxdl-lcmhirpzsa-j
 
* molecular-weight:
 
** 1047.943
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13430]]
+
* [[1.3.1.9-RXN]]
* [[RXN-17688]]
+
* [[ENOYL-ACP-REDUCT-NADH-RXN]]
 +
* [[ENOYL-ACP-REDUCT-NADPH-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12978]]
+
* [[1.3.1.9-RXN]]
* [[RXN-17688]]
+
* [[3-HYDROXYDECANOYL-ACP-DEHYDR-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=icosapentaenoyl-coa}}
+
{{#set: common-name=a trans-2-enoyl-[acyl-carrier protein]}}
{{#set: inchi-key=inchikey=jwzlrycddxhxdl-lcmhirpzsa-j}}
 
{{#set: molecular-weight=1047.943}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite TRANS-D2-ENOYL-ACP

  • common-name:
    • a trans-2-enoyl-[acyl-carrier protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a trans-2-enoyl-[acyl-carrier protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.