Difference between revisions of "TRANS-D2-ENOYL-ACP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9973 == * common-name: ** an [eif5a-precursor]-deoxyhypusine == Reaction(s) known to consume the compound == * DEOXYHYPUSINE-MONOOX...")
(Created page with "Category:metabolite == Metabolite CPD-17814 == * common-name: ** (11z)-(s)-3-hydroxyhexadec-11-enoyl-coa * smiles: ** ccccc=ccccccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9973 ==
+
== Metabolite CPD-17814 ==
 
* common-name:
 
* common-name:
** an [eif5a-precursor]-deoxyhypusine
+
** (11z)-(s)-3-hydroxyhexadec-11-enoyl-coa
 +
* smiles:
 +
** ccccc=ccccccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
 +
* inchi-key:
 +
** shgdvnglfxviak-bfvorphasa-j
 +
* molecular-weight:
 +
** 1015.898
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DEOXYHYPUSINE-MONOOXYGENASE-RXN]]
+
* [[RXN-16559]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.5.1.46-RXN]]
+
* [[RXN-16558]]
* [[RXN-13417]]
+
* [[RXN-16559]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an [eif5a-precursor]-deoxyhypusine}}
+
{{#set: common-name=(11z)-(s)-3-hydroxyhexadec-11-enoyl-coa}}
 +
{{#set: inchi-key=inchikey=shgdvnglfxviak-bfvorphasa-j}}
 +
{{#set: molecular-weight=1015.898}}

Revision as of 18:56, 14 January 2021

Metabolite CPD-17814

  • common-name:
    • (11z)-(s)-3-hydroxyhexadec-11-enoyl-coa
  • smiles:
    • ccccc=ccccccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
  • inchi-key:
    • shgdvnglfxviak-bfvorphasa-j
  • molecular-weight:
    • 1015.898

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality