Difference between revisions of "TRANS-D2-ENOYL-COA"

Latest revision as of 11:15, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite COPROPORPHYRIN_III ==
+== Metabolite TRANS-D2-ENOYL-COA ==
 * common-name:
-** coproporphyrin iii
+** a (2e)-alkan-2-enoyl-coa
-* smiles:
-** cc1(=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=cc3(c(ccc(=o)[o-])=c(c)c(=cc(=c(ccc([o-])=o)1)n2)n=3))n4))=n5)))
-* inchi-key:
-** jwfcywsmnrlxlx-ujjxfscmsa-j
-* molecular-weight:
-** 650.687
 == Reaction(s) known to consume the compound ==
-* [[RXN-17518]]
+* [[ENOYL-COA-DELTA-ISOM-RXN]]
+* [[ENOYL-COA-HYDRAT-RXN]]
+* [[RXN-7699]]
+* [[RXN-7836]]
+* [[TRANSENOYLCOARED-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-17517]]
+* [[ACYL-COA-OXIDASE-RXN]]
+* [[ACYLCOADEHYDROG-RXN]]
+* [[ENOYL-COA-DELTA-ISOM-RXN]]
+* [[RXN-11026]]
+* [[RXN-7699]]
+* [[RXN-7836]]
+* [[RXN-7911]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=coproporphyrin iii}}
+{{#set: common-name=a (2e)-alkan-2-enoyl-coa}}
-{{#set: inchi-key=inchikey=jwfcywsmnrlxlx-ujjxfscmsa-j}}
-{{#set: molecular-weight=650.687}}