Difference between revisions of "TREHALOSE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ19102 == * transcription-direction: ** negative * right-end-position: ** 396753 * left-end-position: ** 392811 * centisome-position: ** 34.43243...") |
(Created page with "Category:metabolite == Metabolite TREHALOSE == * common-name: ** α,α-trehalose * smiles: ** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)co)o)o)o)))o * inchi-key: ** hdt...") |
||
| (8 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite TREHALOSE == |
| − | * | + | * common-name: |
| − | ** | + | ** α,α-trehalose |
| − | * | + | * smiles: |
| − | ** | + | ** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)co)o)o)o)))o |
| − | * | + | * inchi-key: |
| − | ** | + | ** hdtrylnuvzcqoy-lizsdcnhsa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 342.299 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[TREHALA-RXN]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[TREHALOSEPHOSPHA-RXN]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=α,α-trehalose}} | |
| − | + | {{#set: inchi-key=inchikey=hdtrylnuvzcqoy-lizsdcnhsa-n}} | |
| − | + | {{#set: molecular-weight=342.299}} | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite TREHALOSE
- common-name:
- α,α-trehalose
- smiles:
- c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)co)o)o)o)))o
- inchi-key:
- hdtrylnuvzcqoy-lizsdcnhsa-n
- molecular-weight:
- 342.299
