Difference between revisions of "TREHALOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ09402 == * transcription-direction: ** positive * right-end-position: ** 233332 * left-end-position: ** 228598 * centisome-position: ** 54.75624...")
(Created page with "Category:metabolite == Metabolite TREHALOSE == * common-name: ** α,α-trehalose * smiles: ** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)co)o)o)o)))o * inchi-key: ** hdt...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ09402 ==
+
== Metabolite TREHALOSE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** α,α-trehalose
−
* right-end-position:
+
* smiles:
−
** 233332
+
** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)co)o)o)o)))o
−
* left-end-position:
+
* inchi-key:
−
** 228598
+
** hdtrylnuvzcqoy-lizsdcnhsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 54.75624   
+
** 342.299
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[TREHALA-RXN]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[PEROXID-RXN]]
+
* [[TREHALOSEPHOSPHA-RXN]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=α,α-trehalose}}
−
* [[RXN-14240]]
+
{{#set: inchi-key=inchikey=hdtrylnuvzcqoy-lizsdcnhsa-n}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=342.299}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-15288]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17352]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-8635]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7214]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-7445]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-5466]]
 
−
** '''2''' reactions found over '''10''' reactions in the full pathway
 
−
* [[PWY-6824]]
 
−
** '''2''' reactions found over '''10''' reactions in the full pathway
 
−
* [[PWY-5469]]
 
−
** '''2''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-5461]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=233332}}
 
−
{{#set: left-end-position=228598}}
 
−
{{#set: centisome-position=54.75624    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=6}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite TREHALOSE

  • common-name:
    • α,α-trehalose
  • smiles:
    • c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)co)o)o)o)))o
  • inchi-key:
    • hdtrylnuvzcqoy-lizsdcnhsa-n
  • molecular-weight:
    • 342.299

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=TREHALOSE&oldid=137686"